C20H22FNO5 — CID 101057375
(4-fluorophenyl) (2R,3S)-3-hydroxy-4-methyl-2-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 101057375) has the molecular formula C20H22FNO5 and a molecular weight of 375.40 g/mol. Its IUPAC name is (4-fluorophenyl) (2R,3S)-3-hydroxy-4-methyl-2-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | (4-fluorophenyl) (2R,3S)-3-hydroxy-4-methyl-2-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 101057375 |
| Molecular Formula | C20H22FNO5 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | (4-fluorophenyl) (2R,3S)-3-hydroxy-4-methyl-2-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | CC(C)[C@H](O)[C@@H](NC(=O)OCc1ccccc1)C(=O)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C20H22FNO5/c1-13(2)18(23)17(19(24)27-16-10-8-15(21)9-11-16)22-20(25)26-12-14-6-4-3-5-7-14/h3-11,13,17-18,23H,12H2,1-2H3,(H,22,25)/t17-,18+/m1/s1 |
| InChIKey | QHKZEBVXYWUJEW-MSOLQXFVSA-N |
| XLogP | 3.04 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|