C22H24INO6 — CID 22035926
[4-[2-(iodomethoxy)-2-oxoethyl]phenyl] 3-methyl-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 22035926) has the molecular formula C22H24INO6 and a molecular weight of 525.34 g/mol. Its IUPAC name is [4-[2-(iodomethoxy)-2-oxoethyl]phenyl] 3-methyl-2-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | [4-[2-(iodomethoxy)-2-oxoethyl]phenyl] 3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 22035926 |
| Molecular Formula | C22H24INO6 |
| Molecular Weight | 525.34 g/mol |
| Exact Mass | 525.06 |
| IUPAC Name | [4-[2-(iodomethoxy)-2-oxoethyl]phenyl] 3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | CC(C)C(NC(=O)OCc1ccccc1)C(=O)Oc1ccc(CC(=O)OCI)cc1 |
| InChI | InChI=1S/C22H24INO6/c1-15(2)20(24-22(27)28-13-17-6-4-3-5-7-17)21(26)30-18-10-8-16(9-11-18)12-19(25)29-14-23/h3-11,15,20H,12-14H2,1-2H3,(H,24,27) |
| InChIKey | WCLLHZAGTXRWOA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.34 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|