C20H21IN2O7 — CID 139911293
iodomethyl 2-[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxy-6-oxo-1H-pyridine-3-carboxylate (PubChem CID 139911293) has the molecular formula C20H21IN2O7 and a molecular weight of 528.30 g/mol. Its IUPAC name is iodomethyl 2-[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxy-6-oxo-1H-pyridine-3-carboxylate.
| Compound Name | iodomethyl 2-[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxy-6-oxo-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 139911293 |
| Molecular Formula | C20H21IN2O7 |
| Molecular Weight | 528.30 g/mol |
| Exact Mass | 528.04 |
| IUPAC Name | iodomethyl 2-[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxy-6-oxo-1H-pyridine-3-carboxylate |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)Oc1[nH]c(=O)ccc1C(=O)OCI |
| InChI | InChI=1S/C20H21IN2O7/c1-12(2)16(23-20(27)28-10-13-6-4-3-5-7-13)19(26)30-17-14(18(25)29-11-21)8-9-15(24)22-17/h3-9,12,16H,10-11H2,1-2H3,(H,22,24)(H,23,27)/t16-/m0/s1 |
| InChIKey | ZVQDPPMJONSHBM-INIZCTEOSA-N |
| XLogP | 2.78 |
| TPSA | 123.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.30 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|