C21H23IN2O7 — CID 70163932
iodomethyl 1-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxymethyl]-6-oxopyridine-3-carboxylate (PubChem CID 70163932) has the molecular formula C21H23IN2O7 and a molecular weight of 542.33 g/mol. Its IUPAC name is iodomethyl 1-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxymethyl]-6-oxopyridine-3-carboxylate.
| Compound Name | iodomethyl 1-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxymethyl]-6-oxopyridine-3-carboxylate |
|---|---|
| PubChem CID | 70163932 |
| Molecular Formula | C21H23IN2O7 |
| Molecular Weight | 542.33 g/mol |
| Exact Mass | 542.05 |
| IUPAC Name | iodomethyl 1-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxymethyl]-6-oxopyridine-3-carboxylate |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)OCn1cc(C(=O)OCI)ccc1=O |
| InChI | InChI=1S/C21H23IN2O7/c1-14(2)18(23-21(28)29-11-15-6-4-3-5-7-15)20(27)31-13-24-10-16(8-9-17(24)25)19(26)30-12-22/h3-10,14,18H,11-13H2,1-2H3,(H,23,28)/t18-/m0/s1 |
| InChIKey | PIQXVPDZDSHLJC-SFHVURJKSA-N |
| XLogP | 2.85 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|