C23H27IN2O7 — CID 152745634
iodomethyl 1-[1-[(2S,3S)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]oxyethyl]-6-oxopyridine-3-carboxylate (PubChem CID 152745634) has the molecular formula C23H27IN2O7 and a molecular weight of 570.38 g/mol. Its IUPAC name is iodomethyl 1-[1-[(2S,3S)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]oxyethyl]-6-oxopyridine-3-carboxylate.
| Compound Name | iodomethyl 1-[1-[(2S,3S)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]oxyethyl]-6-oxopyridine-3-carboxylate |
|---|---|
| PubChem CID | 152745634 |
| Molecular Formula | C23H27IN2O7 |
| Molecular Weight | 570.38 g/mol |
| Exact Mass | 570.09 |
| IUPAC Name | iodomethyl 1-[1-[(2S,3S)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]oxyethyl]-6-oxopyridine-3-carboxylate |
| SMILES | CC[C@H](C)[C@H](NC(=O)OCc1ccccc1)C(=O)OC(C)n1cc(C(=O)OCI)ccc1=O |
| InChI | InChI=1S/C23H27IN2O7/c1-4-15(2)20(25-23(30)31-13-17-8-6-5-7-9-17)22(29)33-16(3)26-12-18(10-11-19(26)27)21(28)32-14-24/h5-12,15-16,20H,4,13-14H2,1-3H3,(H,25,30)/t15-,16?,20-/m0/s1 |
| InChIKey | RRZXBNUKXIGWGR-HWYGMYFGSA-N |
| XLogP | 3.80 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|