C19H24N2O8 — CID 70364740
methyl N-methoxycarbonyl-N-[(3S,4S)-4-methyl-2-oxo-3-(phenylmethoxycarbonylamino)hexanoyl]carbamate (PubChem CID 70364740) has the molecular formula C19H24N2O8 and a molecular weight of 408.41 g/mol. Its IUPAC name is methyl N-methoxycarbonyl-N-[(3S,4S)-4-methyl-2-oxo-3-(phenylmethoxycarbonylamino)hexanoyl]carbamate.
| Compound Name | methyl N-methoxycarbonyl-N-[(3S,4S)-4-methyl-2-oxo-3-(phenylmethoxycarbonylamino)hexanoyl]carbamate |
|---|---|
| PubChem CID | 70364740 |
| Molecular Formula | C19H24N2O8 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | methyl N-methoxycarbonyl-N-[(3S,4S)-4-methyl-2-oxo-3-(phenylmethoxycarbonylamino)hexanoyl]carbamate |
| SMILES | CC[C@H](C)[C@H](NC(=O)OCc1ccccc1)C(=O)C(=O)N(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C19H24N2O8/c1-5-12(2)14(20-17(24)29-11-13-9-7-6-8-10-13)15(22)16(23)21(18(25)27-3)19(26)28-4/h6-10,12,14H,5,11H2,1-4H3,(H,20,24)/t12-,14-/m0/s1 |
| InChIKey | RACQOXWUGCDVJG-JSGCOSHPSA-N |
| XLogP | 2.26 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|