C32H41IN2O10 — CID 154374576
iodomethyl 2-methyl-3-[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxy-2-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxymethyl]propanoate (PubChem CID 154374576) has the molecular formula C32H41IN2O10 and a molecular weight of 740.59 g/mol. Its IUPAC name is iodomethyl 2-methyl-3-[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxy-2-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxymethyl]propanoate.
| Compound Name | iodomethyl 2-methyl-3-[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxy-2-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxymethyl]propanoate |
|---|---|
| PubChem CID | 154374576 |
| Molecular Formula | C32H41IN2O10 |
| Molecular Weight | 740.59 g/mol |
| Exact Mass | 740.18 |
| IUPAC Name | iodomethyl 2-methyl-3-[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxy-2-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxymethyl]propanoate |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)OCC(C)(COC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)C)C(=O)OCI |
| InChI | InChI=1S/C32H41IN2O10/c1-21(2)25(34-30(39)41-16-23-12-8-6-9-13-23)27(36)43-18-32(5,29(38)45-20-33)19-44-28(37)26(22(3)4)35-31(40)42-17-24-14-10-7-11-15-24/h6-15,21-22,25-26H,16-20H2,1-5H3,(H,34,39)(H,35,40)/t25-,26-/m0/s1 |
| InChIKey | MPWHJHMDSCNOLM-UIOOFZCWSA-N |
| XLogP | 4.92 |
| TPSA | 155.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.59 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|