C21H30ClNO6 — CID 23387570
chloromethyl 2,2-dimethyl-5-[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxypentanoate (PubChem CID 23387570) has the molecular formula C21H30ClNO6 and a molecular weight of 427.93 g/mol. Its IUPAC name is chloromethyl 2,2-dimethyl-5-[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxypentanoate.
| Compound Name | chloromethyl 2,2-dimethyl-5-[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxypentanoate |
|---|---|
| PubChem CID | 23387570 |
| Molecular Formula | C21H30ClNO6 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | chloromethyl 2,2-dimethyl-5-[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxypentanoate |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)OCCCC(C)(C)C(=O)OCCl |
| InChI | InChI=1S/C21H30ClNO6/c1-15(2)17(23-20(26)28-13-16-9-6-5-7-10-16)18(24)27-12-8-11-21(3,4)19(25)29-14-22/h5-7,9-10,15,17H,8,11-14H2,1-4H3,(H,23,26)/t17-/m0/s1 |
| InChIKey | IBXWPAPGWWFGDE-KRWDZBQOSA-N |
| XLogP | 4.03 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|