C28H37NO7 — CID 23387549
(4-methoxyphenyl)methyl 2,2-dimethyl-5-[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxypentanoate (PubChem CID 23387549) has the molecular formula C28H37NO7 and a molecular weight of 499.60 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 2,2-dimethyl-5-[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxypentanoate.
| Compound Name | (4-methoxyphenyl)methyl 2,2-dimethyl-5-[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxypentanoate |
|---|---|
| PubChem CID | 23387549 |
| Molecular Formula | C28H37NO7 |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | (4-methoxyphenyl)methyl 2,2-dimethyl-5-[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxypentanoate |
| SMILES | COc1ccc(COC(=O)C(C)(C)CCCOC(=O)[C@@H](NC(=O)OCc2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C28H37NO7/c1-20(2)24(29-27(32)36-19-21-10-7-6-8-11-21)25(30)34-17-9-16-28(3,4)26(31)35-18-22-12-14-23(33-5)15-13-22/h6-8,10-15,20,24H,9,16-19H2,1-5H3,(H,29,32)/t24-/m0/s1 |
| InChIKey | GODJEPOZAYWMIV-DEOSSOPVSA-N |
| XLogP | 5.04 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|