C18H24ClNO6 — CID 68766981
[4-(chloromethoxy)-4-oxobutyl] (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 68766981) has the molecular formula C18H24ClNO6 and a molecular weight of 385.84 g/mol. Its IUPAC name is [4-(chloromethoxy)-4-oxobutyl] (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | [4-(chloromethoxy)-4-oxobutyl] (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 68766981 |
| Molecular Formula | C18H24ClNO6 |
| Molecular Weight | 385.84 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | [4-(chloromethoxy)-4-oxobutyl] (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)OCCCC(=O)OCCl |
| InChI | InChI=1S/C18H24ClNO6/c1-13(2)16(17(22)24-10-6-9-15(21)26-12-19)20-18(23)25-11-14-7-4-3-5-8-14/h3-5,7-8,13,16H,6,9-12H2,1-2H3,(H,20,23)/t16-/m0/s1 |
| InChIKey | WXEWTIGJQRNYHM-INIZCTEOSA-N |
| XLogP | 3.00 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.84 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|