C17H22ClNO7 — CID 23387519
(3-carboxyoxy-3-chloropropyl) (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 23387519) has the molecular formula C17H22ClNO7 and a molecular weight of 387.82 g/mol. Its IUPAC name is (3-carboxyoxy-3-chloropropyl) (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | (3-carboxyoxy-3-chloropropyl) (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 23387519 |
| Molecular Formula | C17H22ClNO7 |
| Molecular Weight | 387.82 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | (3-carboxyoxy-3-chloropropyl) (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)OCCC(Cl)OC(=O)O |
| InChI | InChI=1S/C17H22ClNO7/c1-11(2)14(15(20)24-9-8-13(18)26-17(22)23)19-16(21)25-10-12-6-4-3-5-7-12/h3-7,11,13-14H,8-10H2,1-2H3,(H,19,21)(H,22,23)/t13?,14-/m0/s1 |
| InChIKey | UUXBETXWJZWBIC-KZUDCZAMSA-N |
| XLogP | 3.13 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.82 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|