C16H23NO4 — CID 156503381
(4-oxo-4-phenylmethoxybutyl) 2-amino-3-methylbutanoate (PubChem CID 156503381) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is (4-oxo-4-phenylmethoxybutyl) 2-amino-3-methylbutanoate.
| Compound Name | (4-oxo-4-phenylmethoxybutyl) 2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 156503381 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | (4-oxo-4-phenylmethoxybutyl) 2-amino-3-methylbutanoate |
| SMILES | CC(C)C(N)C(=O)OCCCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H23NO4/c1-12(2)15(17)16(19)20-10-6-9-14(18)21-11-13-7-4-3-5-8-13/h3-5,7-8,12,15H,6,9-11,17H2,1-2H3 |
| InChIKey | TVFMWYLBEHWZDA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|