C23H31NO7S — CID 169430102
4-methylbenzenesulfonate;[(2S)-3-methyl-1-oxo-1-(4-oxo-4-phenylmethoxybutoxy)butan-2-yl]azanium (PubChem CID 169430102) has the molecular formula C23H31NO7S and a molecular weight of 465.57 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;[(2S)-3-methyl-1-oxo-1-(4-oxo-4-phenylmethoxybutoxy)butan-2-yl]azanium.
| Compound Name | 4-methylbenzenesulfonate;[(2S)-3-methyl-1-oxo-1-(4-oxo-4-phenylmethoxybutoxy)butan-2-yl]azanium |
|---|---|
| PubChem CID | 169430102 |
| Molecular Formula | C23H31NO7S |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | 4-methylbenzenesulfonate;[(2S)-3-methyl-1-oxo-1-(4-oxo-4-phenylmethoxybutoxy)butan-2-yl]azanium |
| SMILES | CC(C)[C@H]([NH3+])C(=O)OCCCC(=O)OCc1ccccc1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C16H23NO4.C7H8O3S/c1-12(2)15(17)16(19)20-10-6-9-14(18)21-11-13-7-4-3-5-8-13;1-6-2-4-7(5-3-6)11(8,9)10/h3-5,7-8,12,15H,6,9-11,17H2,1-2H3;2-5H,1H3,(H,8,9,10)/t15-;/m0./s1 |
| InChIKey | LHNCXZRIWGVXTN-RSAXXLAASA-N |
| XLogP | 2.22 |
| TPSA | 137.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|