C20H27NO5S — CID 11003739
4-methylbenzenesulfonate;[(2S)-4-methyl-1-oxo-1-phenylmethoxypentan-2-yl]azanium (PubChem CID 11003739) has the molecular formula C20H27NO5S and a molecular weight of 393.51 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;[(2S)-4-methyl-1-oxo-1-phenylmethoxypentan-2-yl]azanium.
| Compound Name | 4-methylbenzenesulfonate;[(2S)-4-methyl-1-oxo-1-phenylmethoxypentan-2-yl]azanium |
|---|---|
| PubChem CID | 11003739 |
| Molecular Formula | C20H27NO5S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 4-methylbenzenesulfonate;[(2S)-4-methyl-1-oxo-1-phenylmethoxypentan-2-yl]azanium |
| SMILES | CC(C)C[C@H]([NH3+])C(=O)OCc1ccccc1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C13H19NO2.C7H8O3S/c1-10(2)8-12(14)13(15)16-9-11-6-4-3-5-7-11;1-6-2-4-7(5-3-6)11(8,9)10/h3-7,10,12H,8-9,14H2,1-2H3;2-5H,1H3,(H,8,9,10)/t12-;/m0./s1 |
| InChIKey | QTQGHKVYLQBJLO-YDALLXLXSA-N |
| XLogP | 2.29 |
| TPSA | 111.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|