C21H29NO5S — CID 74765222
benzyl 3-methyl-2-(methylamino)pentanoate;4-methylbenzenesulfonic acid (PubChem CID 74765222) has the molecular formula C21H29NO5S and a molecular weight of 407.53 g/mol. Its IUPAC name is benzyl 3-methyl-2-(methylamino)pentanoate;4-methylbenzenesulfonic acid.
| Compound Name | benzyl 3-methyl-2-(methylamino)pentanoate;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 74765222 |
| Molecular Formula | C21H29NO5S |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | benzyl 3-methyl-2-(methylamino)pentanoate;4-methylbenzenesulfonic acid |
| SMILES | CCC(C)C(NC)C(=O)OCc1ccccc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C14H21NO2.C7H8O3S/c1-4-11(2)13(15-3)14(16)17-10-12-8-6-5-7-9-12;1-6-2-4-7(5-3-6)11(8,9)10/h5-9,11,13,15H,4,10H2,1-3H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | GCZNZHOPUUULAY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|