C29H27NO7S — CID 131720818
dibenzyl 5-aminobenzene-1,3-dicarboxylate;4-methylbenzenesulfonic acid (PubChem CID 131720818) has the molecular formula C29H27NO7S and a molecular weight of 533.60 g/mol. Its IUPAC name is dibenzyl 5-aminobenzene-1,3-dicarboxylate;4-methylbenzenesulfonic acid.
| Compound Name | dibenzyl 5-aminobenzene-1,3-dicarboxylate;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 131720818 |
| Molecular Formula | C29H27NO7S |
| Molecular Weight | 533.60 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | dibenzyl 5-aminobenzene-1,3-dicarboxylate;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.Nc1cc(C(=O)OCc2ccccc2)cc(C(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C22H19NO4.C7H8O3S/c23-20-12-18(21(24)26-14-16-7-3-1-4-8-16)11-19(13-20)22(25)27-15-17-9-5-2-6-10-17;1-6-2-4-7(5-3-6)11(8,9)10/h1-13H,14-15,23H2;2-5H,1H3,(H,8,9,10) |
| InChIKey | PRWZUCDQQANJAP-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 132.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.60 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|