C27H39NO7S — CID 175175785
N,N-dibutylbutan-1-amine;3-phenylmethoxycarbonyl-5-sulfobenzoic acid (PubChem CID 175175785) has the molecular formula C27H39NO7S and a molecular weight of 521.68 g/mol. Its IUPAC name is N,N-dibutylbutan-1-amine;3-phenylmethoxycarbonyl-5-sulfobenzoic acid.
| Compound Name | N,N-dibutylbutan-1-amine;3-phenylmethoxycarbonyl-5-sulfobenzoic acid |
|---|---|
| PubChem CID | 175175785 |
| Molecular Formula | C27H39NO7S |
| Molecular Weight | 521.68 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | N,N-dibutylbutan-1-amine;3-phenylmethoxycarbonyl-5-sulfobenzoic acid |
| SMILES | CCCCN(CCCC)CCCC.O=C(O)c1cc(C(=O)OCc2ccccc2)cc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C15H12O7S.C12H27N/c16-14(17)11-6-12(8-13(7-11)23(19,20)21)15(18)22-9-10-4-2-1-3-5-10;1-4-7-10-13(11-8-5-2)12-9-6-3/h1-8H,9H2,(H,16,17)(H,19,20,21);4-12H2,1-3H3 |
| InChIKey | GGYXVUILRYLKGO-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.68 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|