C29H44O7PS+ — CID 87592995
benzyl(tributyl)phosphanium;3,5-bis(methoxycarbonyl)benzenesulfonic acid (PubChem CID 87592995) has the molecular formula C29H44O7PS+ and a molecular weight of 567.71 g/mol. Its IUPAC name is benzyl(tributyl)phosphanium;3,5-bis(methoxycarbonyl)benzenesulfonic acid.
| Compound Name | benzyl(tributyl)phosphanium;3,5-bis(methoxycarbonyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 87592995 |
| Molecular Formula | C29H44O7PS+ |
| Molecular Weight | 567.71 g/mol |
| Exact Mass | 567.25 |
| IUPAC Name | benzyl(tributyl)phosphanium;3,5-bis(methoxycarbonyl)benzenesulfonic acid |
| SMILES | CCCC[P+](CCCC)(CCCC)Cc1ccccc1.COC(=O)c1cc(C(=O)OC)cc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C19H34P.C10H10O7S/c1-4-7-15-20(16-8-5-2,17-9-6-3)18-19-13-11-10-12-14-19;1-16-9(11)6-3-7(10(12)17-2)5-8(4-6)18(13,14)15/h10-14H,4-9,15-18H2,1-3H3;3-5H,1-2H3,(H,13,14,15)/q+1; |
| InChIKey | YSABSOUZBCDJCR-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.71 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|