C14H21O7PS — CID 22366904
3,5-bis(methoxycarbonyl)benzenesulfonate;butylphosphanium (PubChem CID 22366904) has the molecular formula C14H21O7PS and a molecular weight of 364.36 g/mol. Its IUPAC name is 3,5-bis(methoxycarbonyl)benzenesulfonate;butylphosphanium.
| Compound Name | 3,5-bis(methoxycarbonyl)benzenesulfonate;butylphosphanium |
|---|---|
| PubChem CID | 22366904 |
| Molecular Formula | C14H21O7PS |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 3,5-bis(methoxycarbonyl)benzenesulfonate;butylphosphanium |
| SMILES | CCCC[PH3+].COC(=O)c1cc(C(=O)OC)cc(S(=O)(=O)[O-])c1 |
| InChI | InChI=1S/C10H10O7S.C4H11P/c1-16-9(11)6-3-7(10(12)17-2)5-8(4-6)18(13,14)15;1-2-3-4-5/h3-5H,1-2H3,(H,13,14,15);2-5H2,1H3 |
| InChIKey | VTTQPKNLLZXKNL-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|