C13H17NO4 — CID 63091629
dimethyl 5-(propylamino)benzene-1,3-dicarboxylate (PubChem CID 63091629) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is dimethyl 5-(propylamino)benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-(propylamino)benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 63091629 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | dimethyl 5-(propylamino)benzene-1,3-dicarboxylate |
| SMILES | CCCNc1cc(C(=O)OC)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C13H17NO4/c1-4-5-14-11-7-9(12(15)17-2)6-10(8-11)13(16)18-3/h6-8,14H,4-5H2,1-3H3 |
| InChIKey | OIOZBYAESYAOJL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |