C12H16N2O4 — CID 117097398
dimethyl 5-(2-aminoethylamino)benzene-1,3-dicarboxylate (PubChem CID 117097398) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is dimethyl 5-(2-aminoethylamino)benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-(2-aminoethylamino)benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 117097398 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | dimethyl 5-(2-aminoethylamino)benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NCCN)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C12H16N2O4/c1-17-11(15)8-5-9(12(16)18-2)7-10(6-8)14-4-3-13/h5-7,14H,3-4,13H2,1-2H3 |
| InChIKey | YXRPLAHSSHDRIC-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |