C25H26N2O10 — CID 4100677
dimethyl 5-[[5-[3,5-bis(methoxycarbonyl)anilino]-5-oxopentanoyl]amino]benzene-1,3-dicarboxylate (PubChem CID 4100677) has the molecular formula C25H26N2O10 and a molecular weight of 514.49 g/mol. Its IUPAC name is dimethyl 5-[[5-[3,5-bis(methoxycarbonyl)anilino]-5-oxopentanoyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[5-[3,5-bis(methoxycarbonyl)anilino]-5-oxopentanoyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 4100677 |
| Molecular Formula | C25H26N2O10 |
| Molecular Weight | 514.49 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | dimethyl 5-[[5-[3,5-bis(methoxycarbonyl)anilino]-5-oxopentanoyl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)CCCC(=O)Nc2cc(C(=O)OC)cc(C(=O)OC)c2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C25H26N2O10/c1-34-22(30)14-8-15(23(31)35-2)11-18(10-14)26-20(28)6-5-7-21(29)27-19-12-16(24(32)36-3)9-17(13-19)25(33)37-4/h8-13H,5-7H2,1-4H3,(H,26,28)(H,27,29) |
| InChIKey | MSGZWKWKRRGOMD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 163.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.49 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|