4-[3,5-bis(methoxycarbonyl)anilino]-4-oxobut-2-enoic acid

C14H13NO7 — CID 771032

IUPAC4-[3,5-bis(methoxycarbonyl)anilino]-4-oxobut-2-enoic acid
SMILESCOC(=O)c1cc(NC(=O)C=CC(=O)O)cc(C(=O)OC)c1
InChIInChI=1S/C14H13NO7/c1-21-13(19)8-5-9(14(20)22-2)7-10(6-8)15-11(16)3-4-12(17)18/h3-7H,1-2H3,(H,15,16)(H,17,18)
InChIKeyMQDKTNLPPBONNN-UHFFFAOYSA-N
MW307.26 g/mol
LogP0.84
Rot. Bonds5

About 4-[3,5-bis(methoxycarbonyl)anilino]-4-oxobut-2-enoic acid

4-[3,5-bis(methoxycarbonyl)anilino]-4-oxobut-2-enoic acid (PubChem CID 771032) has the molecular formula C14H13NO7 and a molecular weight of 307.26 g/mol. Its IUPAC name is 4-[3,5-bis(methoxycarbonyl)anilino]-4-oxobut-2-enoic acid.

Molecular Properties

Compound Name4-[3,5-bis(methoxycarbonyl)anilino]-4-oxobut-2-enoic acid
PubChem CID771032
Molecular FormulaC14H13NO7
Molecular Weight307.26 g/mol
Exact Mass307.07
IUPAC Name4-[3,5-bis(methoxycarbonyl)anilino]-4-oxobut-2-enoic acid
SMILESCOC(=O)c1cc(NC(=O)C=CC(=O)O)cc(C(=O)OC)c1
InChIInChI=1S/C14H13NO7/c1-21-13(19)8-5-9(14(20)22-2)7-10(6-8)15-11(16)3-4-12(17)18/h3-7H,1-2H3,(H,15,16)(H,17,18)
InChIKeyMQDKTNLPPBONNN-UHFFFAOYSA-N
XLogP0.84
TPSA119.00 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500307.26
LogP ≤ 50.84
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 4-[3,5-bis(methoxycarbonyl)anilino]-4-oxobut-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[3,5-bis(methoxycarbonyl)anilino]-4-oxobut-2-enoic acid?
The IUPAC name of 4-[3,5-bis(methoxycarbonyl)anilino]-4-oxobut-2-enoic acid (CID 771032) is 4-[3,5-bis(methoxycarbonyl)anilino]-4-oxobut-2-enoic acid.
What is the SMILES notation for 4-[3,5-bis(methoxycarbonyl)anilino]-4-oxobut-2-enoic acid?
The canonical SMILES for 4-[3,5-bis(methoxycarbonyl)anilino]-4-oxobut-2-enoic acid is COC(=O)c1cc(NC(=O)C=CC(=O)O)cc(C(=O)OC)c1.
What is the InChIKey of 4-[3,5-bis(methoxycarbonyl)anilino]-4-oxobut-2-enoic acid?
The InChIKey is MQDKTNLPPBONNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO7/c1-21-13(19)8-5-9(14(20)22-2)7-10(6-8)15-11(16)3-4-12(17)18/h3-7H,1-2H3,(H,15,16)(H,17,18).
What are the key properties of 4-[3,5-bis(methoxycarbonyl)anilino]-4-oxobut-2-enoic acid?
4-[3,5-bis(methoxycarbonyl)anilino]-4-oxobut-2-enoic acid has a molecular weight of 307.26 g/mol, XLogP of 0.84, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3,5-bis(methoxycarbonyl)anilino]-4-oxobut-2-enoic acid is sourced from PubChem (CID 771032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).