C14H13NO7 — CID 771032
4-[3,5-bis(methoxycarbonyl)anilino]-4-oxobut-2-enoic acid (PubChem CID 771032) has the molecular formula C14H13NO7 and a molecular weight of 307.26 g/mol. Its IUPAC name is 4-[3,5-bis(methoxycarbonyl)anilino]-4-oxobut-2-enoic acid.
| Compound Name | 4-[3,5-bis(methoxycarbonyl)anilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 771032 |
| Molecular Formula | C14H13NO7 |
| Molecular Weight | 307.26 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 4-[3,5-bis(methoxycarbonyl)anilino]-4-oxobut-2-enoic acid |
| SMILES | COC(=O)c1cc(NC(=O)C=CC(=O)O)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C14H13NO7/c1-21-13(19)8-5-9(14(20)22-2)7-10(6-8)15-11(16)3-4-12(17)18/h3-7H,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | MQDKTNLPPBONNN-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.26 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|