C19H16FNO5 — CID 1358416
dimethyl 5-[3-(4-fluorophenyl)prop-2-enoylamino]benzene-1,3-dicarboxylate (PubChem CID 1358416) has the molecular formula C19H16FNO5 and a molecular weight of 357.34 g/mol. Its IUPAC name is dimethyl 5-[3-(4-fluorophenyl)prop-2-enoylamino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[3-(4-fluorophenyl)prop-2-enoylamino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 1358416 |
| Molecular Formula | C19H16FNO5 |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | dimethyl 5-[3-(4-fluorophenyl)prop-2-enoylamino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)C=Cc2ccc(F)cc2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C19H16FNO5/c1-25-18(23)13-9-14(19(24)26-2)11-16(10-13)21-17(22)8-5-12-3-6-15(20)7-4-12/h3-11H,1-2H3,(H,21,22) |
| InChIKey | VIRVEPYXXMRHQZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|