C24H24N2O10 — CID 71122038
dimethyl 5-[[3-[3,5-bis(methoxycarbonyl)anilino]-2-methyl-3-oxopropanoyl]amino]benzene-1,3-dicarboxylate (PubChem CID 71122038) has the molecular formula C24H24N2O10 and a molecular weight of 500.46 g/mol. Its IUPAC name is dimethyl 5-[[3-[3,5-bis(methoxycarbonyl)anilino]-2-methyl-3-oxopropanoyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[3-[3,5-bis(methoxycarbonyl)anilino]-2-methyl-3-oxopropanoyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 71122038 |
| Molecular Formula | C24H24N2O10 |
| Molecular Weight | 500.46 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | dimethyl 5-[[3-[3,5-bis(methoxycarbonyl)anilino]-2-methyl-3-oxopropanoyl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)C(C)C(=O)Nc2cc(C(=O)OC)cc(C(=O)OC)c2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C24H24N2O10/c1-12(19(27)25-17-8-13(21(29)33-2)6-14(9-17)22(30)34-3)20(28)26-18-10-15(23(31)35-4)7-16(11-18)24(32)36-5/h6-12H,1-5H3,(H,25,27)(H,26,28) |
| InChIKey | PELXUJMTSJPQIO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 163.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.46 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|