C14H18N2O5 — CID 61254635
dimethyl 5-(3-aminobutanoylamino)benzene-1,3-dicarboxylate (PubChem CID 61254635) has the molecular formula C14H18N2O5 and a molecular weight of 294.31 g/mol. Its IUPAC name is dimethyl 5-(3-aminobutanoylamino)benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-(3-aminobutanoylamino)benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 61254635 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | dimethyl 5-(3-aminobutanoylamino)benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)CC(C)N)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C14H18N2O5/c1-8(15)4-12(17)16-11-6-9(13(18)20-2)5-10(7-11)14(19)21-3/h5-8H,4,15H2,1-3H3,(H,16,17) |
| InChIKey | AIMRCPZGRLSPLD-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |