C16H20N2O5S — CID 4941797
dimethyl 5-(3-methylbutanoylcarbamothioylamino)benzene-1,3-dicarboxylate (PubChem CID 4941797) has the molecular formula C16H20N2O5S and a molecular weight of 352.41 g/mol. Its IUPAC name is dimethyl 5-(3-methylbutanoylcarbamothioylamino)benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-(3-methylbutanoylcarbamothioylamino)benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 4941797 |
| Molecular Formula | C16H20N2O5S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | dimethyl 5-(3-methylbutanoylcarbamothioylamino)benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=S)NC(=O)CC(C)C)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C16H20N2O5S/c1-9(2)5-13(19)18-16(24)17-12-7-10(14(20)22-3)6-11(8-12)15(21)23-4/h6-9H,5H2,1-4H3,(H2,17,18,19,24) |
| InChIKey | JUEWUCUDWMHXJQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|