C24H28N2O8S — CID 3951324
dimethyl 5-[(3,4,5-triethoxybenzoyl)carbamothioylamino]benzene-1,3-dicarboxylate (PubChem CID 3951324) has the molecular formula C24H28N2O8S and a molecular weight of 504.56 g/mol. Its IUPAC name is dimethyl 5-[(3,4,5-triethoxybenzoyl)carbamothioylamino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[(3,4,5-triethoxybenzoyl)carbamothioylamino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 3951324 |
| Molecular Formula | C24H28N2O8S |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | dimethyl 5-[(3,4,5-triethoxybenzoyl)carbamothioylamino]benzene-1,3-dicarboxylate |
| SMILES | CCOc1cc(C(=O)NC(=S)Nc2cc(C(=O)OC)cc(C(=O)OC)c2)cc(OCC)c1OCC |
| InChI | InChI=1S/C24H28N2O8S/c1-6-32-18-12-14(13-19(33-7-2)20(18)34-8-3)21(27)26-24(35)25-17-10-15(22(28)30-4)9-16(11-17)23(29)31-5/h9-13H,6-8H2,1-5H3,(H2,25,26,27,35) |
| InChIKey | WETBOZKEYMDCIX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 121.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|