C22H27N3O5S — CID 2899704
N-[(4-acetamidophenyl)carbamothioyl]-3,4,5-triethoxybenzamide (PubChem CID 2899704) has the molecular formula C22H27N3O5S and a molecular weight of 445.54 g/mol. Its IUPAC name is N-[(4-acetamidophenyl)carbamothioyl]-3,4,5-triethoxybenzamide.
| Compound Name | N-[(4-acetamidophenyl)carbamothioyl]-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 2899704 |
| Molecular Formula | C22H27N3O5S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | N-[(4-acetamidophenyl)carbamothioyl]-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)NC(=S)Nc2ccc(NC(C)=O)cc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C22H27N3O5S/c1-5-28-18-12-15(13-19(29-6-2)20(18)30-7-3)21(27)25-22(31)24-17-10-8-16(9-11-17)23-14(4)26/h8-13H,5-7H2,1-4H3,(H,23,26)(H2,24,25,27,31) |
| InChIKey | KCZWIDOHVCWNCT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|