C26H35N3O4S — CID 26020558
3,4,5-triethoxy-N-[[4-[(2S)-2-methylpiperidin-1-yl]phenyl]carbamothioyl]benzamide (PubChem CID 26020558) has the molecular formula C26H35N3O4S and a molecular weight of 485.65 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[[4-[(2S)-2-methylpiperidin-1-yl]phenyl]carbamothioyl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[[4-[(2S)-2-methylpiperidin-1-yl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 26020558 |
| Molecular Formula | C26H35N3O4S |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | 3,4,5-triethoxy-N-[[4-[(2S)-2-methylpiperidin-1-yl]phenyl]carbamothioyl]benzamide |
| SMILES | CCOc1cc(C(=O)NC(=S)Nc2ccc(N3CCCC[C@@H]3C)cc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C26H35N3O4S/c1-5-31-22-16-19(17-23(32-6-2)24(22)33-7-3)25(30)28-26(34)27-20-11-13-21(14-12-20)29-15-9-8-10-18(29)4/h11-14,16-18H,5-10,15H2,1-4H3,(H2,27,28,30,34)/t18-/m0/s1 |
| InChIKey | ANRDDEBCWOLRDL-SFHVURJKSA-N |
| XLogP | 5.39 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|