C17H25N3OS — CID 40922060
N-[[4-[(2S)-2-methylpiperidin-1-yl]phenyl]carbamothioyl]butanamide (PubChem CID 40922060) has the molecular formula C17H25N3OS and a molecular weight of 319.47 g/mol. Its IUPAC name is N-[[4-[(2S)-2-methylpiperidin-1-yl]phenyl]carbamothioyl]butanamide.
| Compound Name | N-[[4-[(2S)-2-methylpiperidin-1-yl]phenyl]carbamothioyl]butanamide |
|---|---|
| PubChem CID | 40922060 |
| Molecular Formula | C17H25N3OS |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | N-[[4-[(2S)-2-methylpiperidin-1-yl]phenyl]carbamothioyl]butanamide |
| SMILES | CCCC(=O)NC(=S)Nc1ccc(N2CCCC[C@@H]2C)cc1 |
| InChI | InChI=1S/C17H25N3OS/c1-3-6-16(21)19-17(22)18-14-8-10-15(11-9-14)20-12-5-4-7-13(20)2/h8-11,13H,3-7,12H2,1-2H3,(H2,18,19,21,22)/t13-/m0/s1 |
| InChIKey | SMRKWGGPDFIKAS-ZDUSSCGKSA-N |
| XLogP | 3.68 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|