C27H29N3O2S — CID 26019281
N-[[4-[(2R)-2-methylpiperidin-1-yl]phenyl]carbamothioyl]-4-phenylmethoxybenzamide (PubChem CID 26019281) has the molecular formula C27H29N3O2S and a molecular weight of 459.62 g/mol. Its IUPAC name is N-[[4-[(2R)-2-methylpiperidin-1-yl]phenyl]carbamothioyl]-4-phenylmethoxybenzamide.
| Compound Name | N-[[4-[(2R)-2-methylpiperidin-1-yl]phenyl]carbamothioyl]-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 26019281 |
| Molecular Formula | C27H29N3O2S |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | N-[[4-[(2R)-2-methylpiperidin-1-yl]phenyl]carbamothioyl]-4-phenylmethoxybenzamide |
| SMILES | C[C@@H]1CCCCN1c1ccc(NC(=S)NC(=O)c2ccc(OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C27H29N3O2S/c1-20-7-5-6-18-30(20)24-14-12-23(13-15-24)28-27(33)29-26(31)22-10-16-25(17-11-22)32-19-21-8-3-2-4-9-21/h2-4,8-17,20H,5-7,18-19H2,1H3,(H2,28,29,31,33)/t20-/m1/s1 |
| InChIKey | WBFRZHFOBYJLLJ-HXUWFJFHSA-N |
| XLogP | 5.77 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|