C20H22IN3OS — CID 17116463
2-iodo-N-[[4-(2-methylpiperidin-1-yl)phenyl]carbamothioyl]benzamide (PubChem CID 17116463) has the molecular formula C20H22IN3OS and a molecular weight of 479.39 g/mol. Its IUPAC name is 2-iodo-N-[[4-(2-methylpiperidin-1-yl)phenyl]carbamothioyl]benzamide.
| Compound Name | 2-iodo-N-[[4-(2-methylpiperidin-1-yl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17116463 |
| Molecular Formula | C20H22IN3OS |
| Molecular Weight | 479.39 g/mol |
| Exact Mass | 479.05 |
| IUPAC Name | 2-iodo-N-[[4-(2-methylpiperidin-1-yl)phenyl]carbamothioyl]benzamide |
| SMILES | CC1CCCCN1c1ccc(NC(=S)NC(=O)c2ccccc2I)cc1 |
| InChI | InChI=1S/C20H22IN3OS/c1-14-6-4-5-13-24(14)16-11-9-15(10-12-16)22-20(26)23-19(25)17-7-2-3-8-18(17)21/h2-3,7-12,14H,4-6,13H2,1H3,(H2,22,23,25,26) |
| InChIKey | LSSSJPKIWBWNBP-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.39 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|