C23H24N2O — CID 40922093
N-[4-[(2S)-2-methylpiperidin-1-yl]phenyl]naphthalene-2-carboxamide (PubChem CID 40922093) has the molecular formula C23H24N2O and a molecular weight of 344.46 g/mol. Its IUPAC name is N-[4-[(2S)-2-methylpiperidin-1-yl]phenyl]naphthalene-2-carboxamide.
| Compound Name | N-[4-[(2S)-2-methylpiperidin-1-yl]phenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 40922093 |
| Molecular Formula | C23H24N2O |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | N-[4-[(2S)-2-methylpiperidin-1-yl]phenyl]naphthalene-2-carboxamide |
| SMILES | C[C@H]1CCCCN1c1ccc(NC(=O)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C23H24N2O/c1-17-6-4-5-15-25(17)22-13-11-21(12-14-22)24-23(26)20-10-9-18-7-2-3-8-19(18)16-20/h2-3,7-14,16-17H,4-6,15H2,1H3,(H,24,26)/t17-/m0/s1 |
| InChIKey | YSXYZVXEGFLUGY-KRWDZBQOSA-N |
| XLogP | 5.47 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |