C24H24BrN3OS — CID 40862470
5-bromo-N-[[4-[(2R)-2-methylpiperidin-1-yl]phenyl]carbamothioyl]naphthalene-1-carboxamide (PubChem CID 40862470) has the molecular formula C24H24BrN3OS and a molecular weight of 482.45 g/mol. Its IUPAC name is 5-bromo-N-[[4-[(2R)-2-methylpiperidin-1-yl]phenyl]carbamothioyl]naphthalene-1-carboxamide.
| Compound Name | 5-bromo-N-[[4-[(2R)-2-methylpiperidin-1-yl]phenyl]carbamothioyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 40862470 |
| Molecular Formula | C24H24BrN3OS |
| Molecular Weight | 482.45 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | 5-bromo-N-[[4-[(2R)-2-methylpiperidin-1-yl]phenyl]carbamothioyl]naphthalene-1-carboxamide |
| SMILES | C[C@@H]1CCCCN1c1ccc(NC(=S)NC(=O)c2cccc3c(Br)cccc23)cc1 |
| InChI | InChI=1S/C24H24BrN3OS/c1-16-6-2-3-15-28(16)18-13-11-17(12-14-18)26-24(30)27-23(29)21-9-4-8-20-19(21)7-5-10-22(20)25/h4-5,7-14,16H,2-3,6,15H2,1H3,(H2,26,27,29,30)/t16-/m1/s1 |
| InChIKey | LFPVLHAUTRUYFV-MRXNPFEDSA-N |
| XLogP | 6.11 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.45 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|