C19H14Br2N2O2S — CID 91674612
5-bromo-N-[(3-bromo-4-hydroxy-5-methylphenyl)carbamothioyl]naphthalene-1-carboxamide (PubChem CID 91674612) has the molecular formula C19H14Br2N2O2S and a molecular weight of 494.21 g/mol. Its IUPAC name is 5-bromo-N-[(3-bromo-4-hydroxy-5-methylphenyl)carbamothioyl]naphthalene-1-carboxamide.
| Compound Name | 5-bromo-N-[(3-bromo-4-hydroxy-5-methylphenyl)carbamothioyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 91674612 |
| Molecular Formula | C19H14Br2N2O2S |
| Molecular Weight | 494.21 g/mol |
| Exact Mass | 491.91 |
| IUPAC Name | 5-bromo-N-[(3-bromo-4-hydroxy-5-methylphenyl)carbamothioyl]naphthalene-1-carboxamide |
| SMILES | Cc1cc(NC(=S)NC(=O)c2cccc3c(Br)cccc23)cc(Br)c1O |
| InChI | InChI=1S/C19H14Br2N2O2S/c1-10-8-11(9-16(21)17(10)24)22-19(26)23-18(25)14-6-2-5-13-12(14)4-3-7-15(13)20/h2-9,24H,1H3,(H2,22,23,25,26) |
| InChIKey | KLEJVXFMRFHREB-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.21 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|