C20H15BrN2O3S — CID 91673644
4-[(5-bromonaphthalene-1-carbonyl)carbamothioylamino]-3-methylbenzoic acid (PubChem CID 91673644) has the molecular formula C20H15BrN2O3S and a molecular weight of 443.32 g/mol. Its IUPAC name is 4-[(5-bromonaphthalene-1-carbonyl)carbamothioylamino]-3-methylbenzoic acid.
| Compound Name | 4-[(5-bromonaphthalene-1-carbonyl)carbamothioylamino]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 91673644 |
| Molecular Formula | C20H15BrN2O3S |
| Molecular Weight | 443.32 g/mol |
| Exact Mass | 442.00 |
| IUPAC Name | 4-[(5-bromonaphthalene-1-carbonyl)carbamothioylamino]-3-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1NC(=S)NC(=O)c1cccc2c(Br)cccc12 |
| InChI | InChI=1S/C20H15BrN2O3S/c1-11-10-12(19(25)26)8-9-17(11)22-20(27)23-18(24)15-6-2-5-14-13(15)4-3-7-16(14)21/h2-10H,1H3,(H,25,26)(H2,22,23,24,27) |
| InChIKey | HCRGKSXPKMXFBT-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.32 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|