C19H14Br2N2OS — CID 17112344
5-bromo-N-[(4-bromo-2-methylphenyl)carbamothioyl]naphthalene-1-carboxamide (PubChem CID 17112344) has the molecular formula C19H14Br2N2OS and a molecular weight of 478.21 g/mol. Its IUPAC name is 5-bromo-N-[(4-bromo-2-methylphenyl)carbamothioyl]naphthalene-1-carboxamide.
| Compound Name | 5-bromo-N-[(4-bromo-2-methylphenyl)carbamothioyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 17112344 |
| Molecular Formula | C19H14Br2N2OS |
| Molecular Weight | 478.21 g/mol |
| Exact Mass | 475.92 |
| IUPAC Name | 5-bromo-N-[(4-bromo-2-methylphenyl)carbamothioyl]naphthalene-1-carboxamide |
| SMILES | Cc1cc(Br)ccc1NC(=S)NC(=O)c1cccc2c(Br)cccc12 |
| InChI | InChI=1S/C19H14Br2N2OS/c1-11-10-12(20)8-9-17(11)22-19(25)23-18(24)15-6-2-5-14-13(15)4-3-7-16(14)21/h2-10H,1H3,(H2,22,23,24,25) |
| InChIKey | QOEASVVWESHGBA-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.21 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|