C18H11BrClIN2OS — CID 3568567
N-[(4-bromo-2-iodophenyl)carbamothioyl]-5-chloronaphthalene-1-carboxamide (PubChem CID 3568567) has the molecular formula C18H11BrClIN2OS and a molecular weight of 545.63 g/mol. Its IUPAC name is N-[(4-bromo-2-iodophenyl)carbamothioyl]-5-chloronaphthalene-1-carboxamide.
| Compound Name | N-[(4-bromo-2-iodophenyl)carbamothioyl]-5-chloronaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 3568567 |
| Molecular Formula | C18H11BrClIN2OS |
| Molecular Weight | 545.63 g/mol |
| Exact Mass | 543.85 |
| IUPAC Name | N-[(4-bromo-2-iodophenyl)carbamothioyl]-5-chloronaphthalene-1-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc(Br)cc1I)c1cccc2c(Cl)cccc12 |
| InChI | InChI=1S/C18H11BrClIN2OS/c19-10-7-8-16(15(21)9-10)22-18(25)23-17(24)13-5-1-4-12-11(13)3-2-6-14(12)20/h1-9H,(H2,22,23,24,25) |
| InChIKey | YREFMHJDCXAMGD-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.63 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|