C21H14ClN3OS — CID 4559222
5-chloro-N-(quinolin-8-ylcarbamothioyl)naphthalene-1-carboxamide (PubChem CID 4559222) has the molecular formula C21H14ClN3OS and a molecular weight of 391.88 g/mol. Its IUPAC name is 5-chloro-N-(quinolin-8-ylcarbamothioyl)naphthalene-1-carboxamide.
| Compound Name | 5-chloro-N-(quinolin-8-ylcarbamothioyl)naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 4559222 |
| Molecular Formula | C21H14ClN3OS |
| Molecular Weight | 391.88 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | 5-chloro-N-(quinolin-8-ylcarbamothioyl)naphthalene-1-carboxamide |
| SMILES | O=C(NC(=S)Nc1cccc2cccnc12)c1cccc2c(Cl)cccc12 |
| InChI | InChI=1S/C21H14ClN3OS/c22-17-10-3-7-14-15(17)8-2-9-16(14)20(26)25-21(27)24-18-11-1-5-13-6-4-12-23-19(13)18/h1-12H,(H2,24,25,26,27) |
| InChIKey | RNJCEXCSVFDBRU-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.88 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|