C24H15Cl2N5OS — CID 4503555
5-chloro-N-[(6-chloro-2-phenylbenzotriazol-5-yl)carbamothioyl]naphthalene-1-carboxamide (PubChem CID 4503555) has the molecular formula C24H15Cl2N5OS and a molecular weight of 492.39 g/mol. Its IUPAC name is 5-chloro-N-[(6-chloro-2-phenylbenzotriazol-5-yl)carbamothioyl]naphthalene-1-carboxamide.
| Compound Name | 5-chloro-N-[(6-chloro-2-phenylbenzotriazol-5-yl)carbamothioyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 4503555 |
| Molecular Formula | C24H15Cl2N5OS |
| Molecular Weight | 492.39 g/mol |
| Exact Mass | 491.04 |
| IUPAC Name | 5-chloro-N-[(6-chloro-2-phenylbenzotriazol-5-yl)carbamothioyl]naphthalene-1-carboxamide |
| SMILES | O=C(NC(=S)Nc1cc2nn(-c3ccccc3)nc2cc1Cl)c1cccc2c(Cl)cccc12 |
| InChI | InChI=1S/C24H15Cl2N5OS/c25-18-11-5-8-15-16(18)9-4-10-17(15)23(32)28-24(33)27-20-13-22-21(12-19(20)26)29-31(30-22)14-6-2-1-3-7-14/h1-13H,(H2,27,28,32,33) |
| InChIKey | KFXFEXRDFLBFJP-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.39 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|