C24H22ClN5O4S — CID 1016675
N-[[6-chloro-2-(4-methylphenyl)benzotriazol-5-yl]carbamothioyl]-3,4,5-trimethoxybenzamide (PubChem CID 1016675) has the molecular formula C24H22ClN5O4S and a molecular weight of 511.99 g/mol. Its IUPAC name is N-[[6-chloro-2-(4-methylphenyl)benzotriazol-5-yl]carbamothioyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[[6-chloro-2-(4-methylphenyl)benzotriazol-5-yl]carbamothioyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 1016675 |
| Molecular Formula | C24H22ClN5O4S |
| Molecular Weight | 511.99 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | N-[[6-chloro-2-(4-methylphenyl)benzotriazol-5-yl]carbamothioyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NC(=S)Nc2cc3nn(-c4ccc(C)cc4)nc3cc2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C24H22ClN5O4S/c1-13-5-7-15(8-6-13)30-28-18-11-16(25)17(12-19(18)29-30)26-24(35)27-23(31)14-9-20(32-2)22(34-4)21(10-14)33-3/h5-12H,1-4H3,(H2,26,27,31,35) |
| InChIKey | PHNXTFXHEIFHFU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 99.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.99 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|