C19H22N2O4S — CID 1139114
N-[(2,5-dimethylphenyl)carbamothioyl]-3,4,5-trimethoxybenzamide (PubChem CID 1139114) has the molecular formula C19H22N2O4S and a molecular weight of 374.46 g/mol. Its IUPAC name is N-[(2,5-dimethylphenyl)carbamothioyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[(2,5-dimethylphenyl)carbamothioyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 1139114 |
| Molecular Formula | C19H22N2O4S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | N-[(2,5-dimethylphenyl)carbamothioyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NC(=S)Nc2cc(C)ccc2C)cc(OC)c1OC |
| InChI | InChI=1S/C19H22N2O4S/c1-11-6-7-12(2)14(8-11)20-19(26)21-18(22)13-9-15(23-3)17(25-5)16(10-13)24-4/h6-10H,1-5H3,(H2,20,21,22,26) |
| InChIKey | FVMCNPRXIYSQEM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|