C24H26N4O4S — CID 88882873
3,4,5-trimethoxy-N-[[4-methyl-3-(2-phenylhydrazinyl)phenyl]carbamothioyl]benzamide (PubChem CID 88882873) has the molecular formula C24H26N4O4S and a molecular weight of 466.56 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[[4-methyl-3-(2-phenylhydrazinyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[[4-methyl-3-(2-phenylhydrazinyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 88882873 |
| Molecular Formula | C24H26N4O4S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 3,4,5-trimethoxy-N-[[4-methyl-3-(2-phenylhydrazinyl)phenyl]carbamothioyl]benzamide |
| SMILES | COc1cc(C(=O)NC(=S)Nc2ccc(C)c(NNc3ccccc3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C24H26N4O4S/c1-15-10-11-18(14-19(15)28-27-17-8-6-5-7-9-17)25-24(33)26-23(29)16-12-20(30-2)22(32-4)21(13-16)31-3/h5-14,27-28H,1-4H3,(H2,25,26,29,33) |
| InChIKey | VCSAXHCCRINMFU-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 92.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|