C31H31N5O5 — CID 137136307
3,4,5-trimethoxy-N-[N-[4-methyl-3-[(4-phenylphenyl)carbamoylamino]phenyl]carbamimidoyl]benzamide (PubChem CID 137136307) has the molecular formula C31H31N5O5 and a molecular weight of 553.62 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[N-[4-methyl-3-[(4-phenylphenyl)carbamoylamino]phenyl]carbamimidoyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[N-[4-methyl-3-[(4-phenylphenyl)carbamoylamino]phenyl]carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 137136307 |
| Molecular Formula | C31H31N5O5 |
| Molecular Weight | 553.62 g/mol |
| Exact Mass | 553.23 |
| IUPAC Name | 3,4,5-trimethoxy-N-[N-[4-methyl-3-[(4-phenylphenyl)carbamoylamino]phenyl]carbamimidoyl]benzamide |
| SMILES | [H]/N=C(\NC(=O)c1cc(OC)c(OC)c(OC)c1)Nc1ccc(C)c(NC(=O)Nc2ccc(-c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C31H31N5O5/c1-19-10-13-24(33-30(32)36-29(37)22-16-26(39-2)28(41-4)27(17-22)40-3)18-25(19)35-31(38)34-23-14-11-21(12-15-23)20-8-6-5-7-9-20/h5-18H,1-4H3,(H2,34,35,38)(H3,32,33,36,37) |
| InChIKey | UQUUYCPJQVQEAI-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 133.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.62 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|