C24H24N2O4 — CID 6005452
3,4,5-trimethoxy-N-[(E)-1-(4-phenylphenyl)ethylideneamino]benzamide (PubChem CID 6005452) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[(E)-1-(4-phenylphenyl)ethylideneamino]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[(E)-1-(4-phenylphenyl)ethylideneamino]benzamide |
|---|---|
| PubChem CID | 6005452 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 3,4,5-trimethoxy-N-[(E)-1-(4-phenylphenyl)ethylideneamino]benzamide |
| SMILES | COc1cc(C(=O)N/N=C(\C)c2ccc(-c3ccccc3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C24H24N2O4/c1-16(17-10-12-19(13-11-17)18-8-6-5-7-9-18)25-26-24(27)20-14-21(28-2)23(30-4)22(15-20)29-3/h5-15H,1-4H3,(H,26,27)/b25-16+ |
| InChIKey | YIYCTZGBPGRTOB-PCLIKHOPSA-N |
| XLogP | 4.53 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|