C23H22N2O — CID 4588942
3,4-dimethyl-N-[1-(4-phenylphenyl)ethylideneamino]benzamide (PubChem CID 4588942) has the molecular formula C23H22N2O and a molecular weight of 342.44 g/mol. Its IUPAC name is 3,4-dimethyl-N-[1-(4-phenylphenyl)ethylideneamino]benzamide.
| Compound Name | 3,4-dimethyl-N-[1-(4-phenylphenyl)ethylideneamino]benzamide |
|---|---|
| PubChem CID | 4588942 |
| Molecular Formula | C23H22N2O |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 3,4-dimethyl-N-[1-(4-phenylphenyl)ethylideneamino]benzamide |
| SMILES | CC(=NNC(=O)c1ccc(C)c(C)c1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H22N2O/c1-16-9-10-22(15-17(16)2)23(26)25-24-18(3)19-11-13-21(14-12-19)20-7-5-4-6-8-20/h4-15H,1-3H3,(H,25,26) |
| InChIKey | BJDWSUOTANDPFO-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|