C20H24N2O — CID 19685204
3,4-dimethyl-N-[(E)-1-(4-propylphenyl)ethylideneamino]benzamide (PubChem CID 19685204) has the molecular formula C20H24N2O and a molecular weight of 308.43 g/mol. Its IUPAC name is 3,4-dimethyl-N-[(E)-1-(4-propylphenyl)ethylideneamino]benzamide.
| Compound Name | 3,4-dimethyl-N-[(E)-1-(4-propylphenyl)ethylideneamino]benzamide |
|---|---|
| PubChem CID | 19685204 |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | 3,4-dimethyl-N-[(E)-1-(4-propylphenyl)ethylideneamino]benzamide |
| SMILES | CCCc1ccc(/C(C)=N/NC(=O)c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C20H24N2O/c1-5-6-17-8-11-18(12-9-17)16(4)21-22-20(23)19-10-7-14(2)15(3)13-19/h7-13H,5-6H2,1-4H3,(H,22,23)/b21-16+ |
| InChIKey | PMSJHXDBDIGWPF-LTGZKZEYSA-N |
| XLogP | 4.41 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|