C26H34N4O2 — CID 4173019
N,N'-bis[1-(4-propylphenyl)ethylideneamino]butanediamide (PubChem CID 4173019) has the molecular formula C26H34N4O2 and a molecular weight of 434.58 g/mol. Its IUPAC name is N,N'-bis[1-(4-propylphenyl)ethylideneamino]butanediamide.
| Compound Name | N,N'-bis[1-(4-propylphenyl)ethylideneamino]butanediamide |
|---|---|
| PubChem CID | 4173019 |
| Molecular Formula | C26H34N4O2 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | N,N'-bis[1-(4-propylphenyl)ethylideneamino]butanediamide |
| SMILES | CCCc1ccc(C(C)=NNC(=O)CCC(=O)NN=C(C)c2ccc(CCC)cc2)cc1 |
| InChI | InChI=1S/C26H34N4O2/c1-5-7-21-9-13-23(14-10-21)19(3)27-29-25(31)17-18-26(32)30-28-20(4)24-15-11-22(8-6-2)12-16-24/h9-16H,5-8,17-18H2,1-4H3,(H,29,31)(H,30,32) |
| InChIKey | YPXQGXLLDKSRJS-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|