C17H19N3O — CID 21370947
2-amino-N-[(E)-1-(3,4-dimethylphenyl)ethylideneamino]benzamide (PubChem CID 21370947) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-amino-N-[(E)-1-(3,4-dimethylphenyl)ethylideneamino]benzamide.
| Compound Name | 2-amino-N-[(E)-1-(3,4-dimethylphenyl)ethylideneamino]benzamide |
|---|---|
| PubChem CID | 21370947 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 2-amino-N-[(E)-1-(3,4-dimethylphenyl)ethylideneamino]benzamide |
| SMILES | C/C(=N\NC(=O)c1ccccc1N)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C17H19N3O/c1-11-8-9-14(10-12(11)2)13(3)19-20-17(21)15-6-4-5-7-16(15)18/h4-10H,18H2,1-3H3,(H,20,21)/b19-13+ |
| InChIKey | AEMMJBCJZPAPNY-CPNJWEJPSA-N |
| XLogP | 3.04 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|